C18H28N6O3 — CID 71169289
tert-butyl N-(3-aminopropyl)-N-[3-[(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propyl]carbamate (PubChem CID 71169289) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is tert-butyl N-(3-aminopropyl)-N-[3-[(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-(3-aminopropyl)-N-[3-[(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 71169289 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl N-(3-aminopropyl)-N-[3-[(1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCN)CCCNc1nc2ccccc2[n+]([O-])n1 |
| InChI | InChI=1S/C18H28N6O3/c1-18(2,3)27-17(25)23(12-6-10-19)13-7-11-20-16-21-14-8-4-5-9-15(14)24(26)22-16/h4-5,8-9H,6-7,10-13,19H2,1-3H3,(H,20,21,22) |
| InChIKey | XHVPVSBRDSVDGF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|