C17H34O4Si — CID 71169433
3-[(2R,3R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-3,6-dihydro-2H-pyran-2-yl]propane-1,2-diol (PubChem CID 71169433) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is 3-[(2R,3R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-3,6-dihydro-2H-pyran-2-yl]propane-1,2-diol.
| Compound Name | 3-[(2R,3R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-3,6-dihydro-2H-pyran-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 71169433 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-[(2R,3R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-3,6-dihydro-2H-pyran-2-yl]propane-1,2-diol |
| SMILES | CC[C@@H]1C=CC(CO[Si](C)(C)C(C)(C)C)O[C@@H]1CC(O)CO |
| InChI | InChI=1S/C17H34O4Si/c1-7-13-8-9-15(21-16(13)10-14(19)11-18)12-20-22(5,6)17(2,3)4/h8-9,13-16,18-19H,7,10-12H2,1-6H3/t13-,14?,15?,16-/m1/s1 |
| InChIKey | FHWYTMXJRXWOPI-PRLABOORSA-N |
| XLogP | 3.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|