C28H36F2O2 — CID 71170244
(9R)-8-fluoro-9-(8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran-9-yl)-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran (PubChem CID 71170244) has the molecular formula C28H36F2O2 and a molecular weight of 442.59 g/mol. Its IUPAC name is (9R)-8-fluoro-9-(8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran-9-yl)-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran.
| Compound Name | (9R)-8-fluoro-9-(8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran-9-yl)-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran |
|---|---|
| PubChem CID | 71170244 |
| Molecular Formula | C28H36F2O2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (9R)-8-fluoro-9-(8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran-9-yl)-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran |
| SMILES | CC1=CC2=C(C3OCC(C)CC3C2)C([C@@H]2C3=C(C=C(C)C2F)CC2CC(C)COC32)C1F |
| InChI | InChI=1S/C28H36F2O2/c1-13-5-19-9-17-7-15(3)25(29)23(21(17)27(19)31-11-13)24-22-18(8-16(4)26(24)30)10-20-6-14(2)12-32-28(20)22/h7-8,13-14,19-20,23-28H,5-6,9-12H2,1-4H3/t13?,14?,19?,20?,23-,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | QPHVYGTXZFACQU-JOFODGOESA-N |
| XLogP | 6.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |