About 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid
5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid (PubChem CID 71170480) has the molecular formula C22H20F2N2O4S2
and a molecular weight of 478.54 g/mol. Its IUPAC name is 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid |
| PubChem CID | 71170480 |
| Molecular Formula | C22H20F2N2O4S2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(SCc3c(F)cccc3F)nc2)cc1C(=O)O |
| InChI | InChI=1S/C22H20F2N2O4S2/c1-13(2)16-8-7-15(10-17(16)22(27)28)32(29,30)26-14-6-9-21(25-11-14)31-12-18-19(23)4-3-5-20(18)24/h3-11,13,26H,12H2,1-2H3,(H,27,28) |
| InChIKey | MGXQLOHKJXJZMM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid?
The IUPAC name of 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid (CID 71170480) is 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid.
What is the SMILES notation for 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid?
The canonical SMILES for 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid is CC(C)c1ccc(S(=O)(=O)Nc2ccc(SCc3c(F)cccc3F)nc2)cc1C(=O)O.
What is the InChIKey of 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid?
The InChIKey is MGXQLOHKJXJZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N2O4S2/c1-13(2)16-8-7-15(10-17(16)22(27)28)32(29,30)26-14-6-9-21(25-11-14)31-12-18-19(23)4-3-5-20(18)24/h3-11,13,26H,12H2,1-2H3,(H,27,28).
What are the key properties of 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid?
5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid has a molecular weight of 478.54 g/mol, XLogP of 5.27, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-[(2,6-difluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-propan-2-ylbenzoic acid is sourced from PubChem (CID 71170480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).