C33H27Cl2N4O4S- — CID 71170691
1-[4-[(2-amino-2-oxoethyl)-sulfinatoamino]phenyl]-4-(2,4-dichlorophenyl)-2-[[4-(4-propanoylphenyl)phenyl]methyl]imidazole (PubChem CID 71170691) has the molecular formula C33H27Cl2N4O4S- and a molecular weight of 646.58 g/mol. Its IUPAC name is 1-[4-[(2-amino-2-oxoethyl)-sulfinatoamino]phenyl]-4-(2,4-dichlorophenyl)-2-[[4-(4-propanoylphenyl)phenyl]methyl]imidazole.
| Compound Name | 1-[4-[(2-amino-2-oxoethyl)-sulfinatoamino]phenyl]-4-(2,4-dichlorophenyl)-2-[[4-(4-propanoylphenyl)phenyl]methyl]imidazole |
|---|---|
| PubChem CID | 71170691 |
| Molecular Formula | C33H27Cl2N4O4S- |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | 1-[4-[(2-amino-2-oxoethyl)-sulfinatoamino]phenyl]-4-(2,4-dichlorophenyl)-2-[[4-(4-propanoylphenyl)phenyl]methyl]imidazole |
| SMILES | CCC(=O)c1ccc(-c2ccc(Cc3nc(-c4ccc(Cl)cc4Cl)cn3-c3ccc(N(CC(N)=O)S(=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C33H28Cl2N4O4S/c1-2-31(40)24-9-7-23(8-10-24)22-5-3-21(4-6-22)17-33-37-30(28-16-11-25(34)18-29(28)35)19-38(33)26-12-14-27(15-13-26)39(44(42)43)20-32(36)41/h3-16,18-19H,2,17,20H2,1H3,(H2,36,41)(H,42,43)/p-1 |
| InChIKey | QCFCNMJVULPKFI-UHFFFAOYSA-M |
| XLogP | 6.78 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|