About (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide
(4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 71170886) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 71170886 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1=CC(C(=O)NCCN2CCOCC2)=CC[C@@H]1C |
| InChI | InChI=1S/C15H24N2O2/c1-12-3-4-14(11-13(12)2)15(18)16-5-6-17-7-9-19-10-8-17/h4,11-12H,3,5-10H2,1-2H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | BBWIBFYIMAHEKS-LBPRGKRZSA-N |
| XLogP | 1.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide (CID 71170886) is (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide is CC1=CC(C(=O)NCCN2CCOCC2)=CC[C@@H]1C.
What is the InChIKey of (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide?
The InChIKey is BBWIBFYIMAHEKS-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-12-3-4-14(11-13(12)2)15(18)16-5-6-17-7-9-19-10-8-17/h4,11-12H,3,5-10H2,1-2H3,(H,16,18)/t12-/m0/s1.
What are the key properties of (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide?
(4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide has a molecular weight of 264.37 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,5-dimethyl-N-(2-morpholin-4-ylethyl)cyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 71170886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).