C24H36N4 — CID 71171068
N-(1,4b,8,9,10,10a,10b,12a-octahydroisoquinolino[4,3-c]isoquinolin-12-ylmethyl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 71171068) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is N-(1,4b,8,9,10,10a,10b,12a-octahydroisoquinolino[4,3-c]isoquinolin-12-ylmethyl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(1,4b,8,9,10,10a,10b,12a-octahydroisoquinolino[4,3-c]isoquinolin-12-ylmethyl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 71171068 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | N-(1,4b,8,9,10,10a,10b,12a-octahydroisoquinolino[4,3-c]isoquinolin-12-ylmethyl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCC1=NC2C3CCCC=C3C=NC2C2=CC=CCC21 |
| InChI | InChI=1S/C24H36N4/c1-3-28(4-2)15-9-14-25-17-22-20-12-7-8-13-21(20)23-24(27-22)19-11-6-5-10-18(19)16-26-23/h7-8,10,13,16,19-20,23-25H,3-6,9,11-12,14-15,17H2,1-2H3 |
| InChIKey | SJWXYNGPMYPYAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|