C23H23N3O7 — CID 71171570
2-[carboxymethyl-[[(2S)-3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]-8'-yl]methyl]amino]acetic acid (PubChem CID 71171570) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[carboxymethyl-[[(2S)-3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]-8'-yl]methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[[(2S)-3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]-8'-yl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 71171570 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[carboxymethyl-[[(2S)-3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]-8'-yl]methyl]amino]acetic acid |
| SMILES | CC1(C)c2ccccc2N[C@]12C=Cc1cc([N+](=O)[O-])cc(CN(CC(=O)O)CC(=O)O)c1O2 |
| InChI | InChI=1S/C23H23N3O7/c1-22(2)17-5-3-4-6-18(17)24-23(22)8-7-14-9-16(26(31)32)10-15(21(14)33-23)11-25(12-19(27)28)13-20(29)30/h3-10,24H,11-13H2,1-2H3,(H,27,28)(H,29,30)/t23-/m0/s1 |
| InChIKey | FTNSUFVXTMPLOR-QHCPKHFHSA-N |
| XLogP | 3.07 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|