C14H24O7 — CID 71171615
(1R,6R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol (PubChem CID 71171615) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1R,6R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol.
| Compound Name | (1R,6R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol |
|---|---|
| PubChem CID | 71171615 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,6R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-ol |
| SMILES | CO[C@@H]1OC2COC(C)(C)O[C@H]2C2OC(C)(C)O[C@@H]2C1O |
| InChI | InChI=1S/C14H24O7/c1-13(2)17-6-7-9(19-13)11-10(20-14(3,4)21-11)8(15)12(16-5)18-7/h7-12,15H,6H2,1-5H3/t7?,8?,9-,10-,11?,12-/m1/s1 |
| InChIKey | IYQZQCBBCAWDEO-WXRYPZCXSA-N |
| XLogP | 0.39 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |