C11H17N3O3 — CID 71171636
4-amino-1-[(Z,1R,5R)-5-hydroxy-1-methoxyhex-3-enyl]pyrimidin-2-one (PubChem CID 71171636) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-amino-1-[(Z,1R,5R)-5-hydroxy-1-methoxyhex-3-enyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(Z,1R,5R)-5-hydroxy-1-methoxyhex-3-enyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 71171636 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-amino-1-[(Z,1R,5R)-5-hydroxy-1-methoxyhex-3-enyl]pyrimidin-2-one |
| SMILES | CO[C@H](C/C=C\[C@@H](C)O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C11H17N3O3/c1-8(15)4-3-5-10(17-2)14-7-6-9(12)13-11(14)16/h3-4,6-8,10,15H,5H2,1-2H3,(H2,12,13,16)/b4-3-/t8-,10-/m1/s1 |
| InChIKey | GXDVAEXELVIIHA-CCIFHCDCSA-N |
| XLogP | 0.30 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|