C16H26O6 — CID 71171640
(3aR,6S,6aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 71171640) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (3aR,6S,6aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 71171640 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3aR,6S,6aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCC1(CC)OCC([C@@H]2OC(=O)[C@@H]3OC(CC)(CC)O[C@@H]32)O1 |
| InChI | InChI=1S/C16H26O6/c1-5-15(6-2)18-9-10(20-15)11-12-13(14(17)19-11)22-16(7-3,8-4)21-12/h10-13H,5-9H2,1-4H3/t10?,11-,12+,13+/m0/s1 |
| InChIKey | FGXMCUFHHJYVLH-FJAVPRTDSA-N |
| XLogP | 2.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |