C30H24N4O5 — CID 71171662
ethyl 3-[(4R)-4-acetamidocyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate (PubChem CID 71171662) has the molecular formula C30H24N4O5 and a molecular weight of 520.55 g/mol. Its IUPAC name is ethyl 3-[(4R)-4-acetamidocyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate.
| Compound Name | ethyl 3-[(4R)-4-acetamidocyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
|---|---|
| PubChem CID | 71171662 |
| Molecular Formula | C30H24N4O5 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | ethyl 3-[(4R)-4-acetamidocyclopent-2-en-1-yl]-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
| SMILES | CCOC(=O)N1C(=O)c2c(c3c4ccccc4n(C4C=C[C@H](NC(C)=O)C4)c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C30H24N4O5/c1-3-39-30(38)34-28(36)24-22-18-8-4-6-10-20(18)32-26(22)27-23(25(24)29(34)37)19-9-5-7-11-21(19)33(27)17-13-12-16(14-17)31-15(2)35/h4-13,16-17,32H,3,14H2,1-2H3,(H,31,35)/t16-,17?/m0/s1 |
| InChIKey | VDBHWGZQPSXQEY-BHWOMJMDSA-N |
| XLogP | 5.19 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|