C25H40O5Si — CID 71172194
(2S)-2-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]cyclopentan-1-one (PubChem CID 71172194) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]cyclopentan-1-one.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 71172194 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]cyclopentan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(CO)C(=O)CCC1C1CCC2=CC3(CCC2=C1CO)OCCO3 |
| InChI | InChI=1S/C25H40O5Si/c1-23(2,3)31(4,5)25(16-27)21(8-9-22(25)28)19-7-6-17-14-24(29-12-13-30-24)11-10-18(17)20(19)15-26/h14,19,21,26-27H,6-13,15-16H2,1-5H3/t19?,21?,25-/m1/s1 |
| InChIKey | UFLYNPKSYIRAEN-BPOAOHNVSA-N |
| XLogP | 4.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|