C26H32O3S — CID 71172296
(15S,18R)-11,15-dimethyl-18-(4-methylsulfanylphenyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-diene-5,14-dione (PubChem CID 71172296) has the molecular formula C26H32O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is (15S,18R)-11,15-dimethyl-18-(4-methylsulfanylphenyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-diene-5,14-dione.
| Compound Name | (15S,18R)-11,15-dimethyl-18-(4-methylsulfanylphenyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-diene-5,14-dione |
|---|---|
| PubChem CID | 71172296 |
| Molecular Formula | C26H32O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (15S,18R)-11,15-dimethyl-18-(4-methylsulfanylphenyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-diene-5,14-dione |
| SMILES | CSc1ccc([C@H]2OC[C@H](C)C(=O)CCC(C)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C26H32O3S/c1-16-4-13-24(28)17(2)15-29-26(18-5-9-21(30-3)10-6-18)25-22(16)11-7-19-14-20(27)8-12-23(19)25/h5-6,9-10,14,16-17,22,26H,4,7-8,11-13,15H2,1-3H3/t16?,17-,22?,26+/m0/s1 |
| InChIKey | IXCPEHLYPLAMNV-LOXIVROKSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |