About (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol
(2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol (PubChem CID 71172701) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 71172701 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol |
| SMILES | CC1=C(O)[C@@H](CN2CCCCC2)C(O)C=C1 |
| InChI | InChI=1S/C13H21NO2/c1-10-5-6-12(15)11(13(10)16)9-14-7-3-2-4-8-14/h5-6,11-12,15-16H,2-4,7-9H2,1H3/t11-,12?/m0/s1 |
| InChIKey | DCDUZGMUMRGFMK-PXYINDEMSA-N |
| XLogP | 1.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol?
The IUPAC name of (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol (CID 71172701) is (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol is CC1=C(O)[C@@H](CN2CCCCC2)C(O)C=C1.
What is the InChIKey of (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol?
The InChIKey is DCDUZGMUMRGFMK-PXYINDEMSA-N. The full InChI is InChI=1S/C13H21NO2/c1-10-5-6-12(15)11(13(10)16)9-14-7-3-2-4-8-14/h5-6,11-12,15-16H,2-4,7-9H2,1H3/t11-,12?/m0/s1.
What are the key properties of (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol?
(2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol has a molecular weight of 223.32 g/mol, XLogP of 1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-2-(piperidin-1-ylmethyl)cyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 71172701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).