C14H16N2O2 — CID 7117283
N-[(2R)-butan-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 7117283) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 7117283 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H16N2O2/c1-3-9(2)16-14(18)13(17)11-8-15-12-7-5-4-6-10(11)12/h4-9,15H,3H2,1-2H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | OGSJDLMQXSIQKS-SECBINFHSA-N |
| XLogP | 2.27 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|