C13H27BO4 — CID 71172941
2-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 71172941) has the molecular formula C13H27BO4 and a molecular weight of 258.17 g/mol. Its IUPAC name is 2-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71172941 |
| Molecular Formula | C13H27BO4 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-(3-methoxy-2,3-dimethylbutan-2-yl)oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COC(C)(C)C(C)(C)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H27BO4/c1-10(2,15-9)11(3,4)16-14-17-12(5,6)13(7,8)18-14/h1-9H3 |
| InChIKey | IOKLXWFZJCHSEA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|