About 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one
2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one (PubChem CID 71173184) has the molecular formula C14H15ClN6O
and a molecular weight of 318.77 g/mol. Its IUPAC name is 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one |
| PubChem CID | 71173184 |
| Molecular Formula | C14H15ClN6O |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one |
| SMILES | Cc1cnc(Cn2c(=O)[nH]c3c(C)nc(N)nc32)c(C)c1Cl |
| InChI | InChI=1S/C14H15ClN6O/c1-6-4-17-9(7(2)10(6)15)5-21-12-11(19-14(21)22)8(3)18-13(16)20-12/h4H,5H2,1-3H3,(H,19,22)(H2,16,18,20) |
| InChIKey | BATUBOHNYSKOJU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one?
The IUPAC name of 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one (CID 71173184) is 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one.
What is the SMILES notation for 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one?
The canonical SMILES for 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one is Cc1cnc(Cn2c(=O)[nH]c3c(C)nc(N)nc32)c(C)c1Cl.
What is the InChIKey of 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one?
The InChIKey is BATUBOHNYSKOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN6O/c1-6-4-17-9(7(2)10(6)15)5-21-12-11(19-14(21)22)8(3)18-13(16)20-12/h4H,5H2,1-3H3,(H,19,22)(H2,16,18,20).
What are the key properties of 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one?
2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one has a molecular weight of 318.77 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-[(4-chloro-3,5-dimethyl-2-pyridinyl)methyl]-6-methyl-7H-purin-8-one is sourced from PubChem (CID 71173184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).