C24H19N9S — CID 71173250
1-(1,3-benzothiazol-2-yl)-3-[[2,4-dimethyl-6-(4-methylanilino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile (PubChem CID 71173250) has the molecular formula C24H19N9S and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[[2,4-dimethyl-6-(4-methylanilino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[[2,4-dimethyl-6-(4-methylanilino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 71173250 |
| Molecular Formula | C24H19N9S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[[2,4-dimethyl-6-(4-methylanilino)pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
| SMILES | Cc1ccc(Nc2nc(C)nc(C)c2/N=N/c2nn(-c3nc4ccccc4s3)cc2C#N)cc1 |
| InChI | InChI=1S/C24H19N9S/c1-14-8-10-18(11-9-14)28-23-21(15(2)26-16(3)27-23)30-31-22-17(12-25)13-33(32-22)24-29-19-6-4-5-7-20(19)34-24/h4-11,13H,1-3H3,(H,26,27,28)/b31-30+ |
| InChIKey | MLNPKYXNBUMVPG-NVQSTNCTSA-N |
| XLogP | 6.23 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|