About 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol
4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol (PubChem CID 71173362) has the molecular formula C13H14FNO
and a molecular weight of 219.26 g/mol. Its IUPAC name is 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 71173362 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1C(c2ccc(F)cc2)=C(O)C=CC1N |
| InChI | InChI=1S/C13H14FNO/c1-8-11(15)6-7-12(16)13(8)9-2-4-10(14)5-3-9/h2-8,11,16H,15H2,1H3 |
| InChIKey | KOVWVNJXOBDSRZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol (CID 71173362) is 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol is CC1C(c2ccc(F)cc2)=C(O)C=CC1N.
What is the InChIKey of 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol?
The InChIKey is KOVWVNJXOBDSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO/c1-8-11(15)6-7-12(16)13(8)9-2-4-10(14)5-3-9/h2-8,11,16H,15H2,1H3.
What are the key properties of 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol?
4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol has a molecular weight of 219.26 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(4-fluorophenyl)-3-methylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 71173362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).