C16H19NO — CID 71173461
(8'aR)-spiro[1,3-dihydroindole-2,2'-4a,5,6,7,8,8a-hexahydrochromene] (PubChem CID 71173461) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (8'aR)-spiro[1,3-dihydroindole-2,2'-4a,5,6,7,8,8a-hexahydrochromene].
| Compound Name | (8'aR)-spiro[1,3-dihydroindole-2,2'-4a,5,6,7,8,8a-hexahydrochromene] |
|---|---|
| PubChem CID | 71173461 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (8'aR)-spiro[1,3-dihydroindole-2,2'-4a,5,6,7,8,8a-hexahydrochromene] |
| SMILES | C1=CC2(Cc3ccccc3N2)O[C@@H]2CCCCC12 |
| InChI | InChI=1S/C16H19NO/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16/h1,3,6-7,9-10,12,15,17H,2,4-5,8,11H2/t12?,15-,16?/m1/s1 |
| InChIKey | FHKOURPMMQQGGV-DSSZZKGTSA-N |
| XLogP | 3.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|