C29H40O2 — CID 71173530
(2R)-4-[[(2S,4aS,10aS)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]-phenylmethoxy]pentan-2-ol (PubChem CID 71173530) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2R)-4-[[(2S,4aS,10aS)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]-phenylmethoxy]pentan-2-ol.
| Compound Name | (2R)-4-[[(2S,4aS,10aS)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]-phenylmethoxy]pentan-2-ol |
|---|---|
| PubChem CID | 71173530 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2R)-4-[[(2S,4aS,10aS)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]-phenylmethoxy]pentan-2-ol |
| SMILES | CC(C[C@@H](C)O)OC(c1ccccc1)[C@H]1CC[C@]2(C)c3ccccc3CC[C@H]2C1(C)C |
| InChI | InChI=1S/C29H40O2/c1-20(30)19-21(2)31-27(23-12-7-6-8-13-23)25-17-18-29(5)24-14-10-9-11-22(24)15-16-26(29)28(25,3)4/h6-14,20-21,25-27,30H,15-19H2,1-5H3/t20-,21?,25-,26+,27?,29-/m1/s1 |
| InChIKey | LVWRZWJARJYSEF-KTELXCGWSA-N |
| XLogP | 6.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |