About 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol
2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol (PubChem CID 71173532) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol.
Molecular Properties
| Compound Name | 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol |
| PubChem CID | 71173532 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol |
| SMILES | CCCCCCC(C)c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1 |
| InChI | InChI=1S/C20H32O2/c1-3-4-5-6-8-15(2)16-11-12-19(20(22)14-16)17-9-7-10-18(21)13-17/h11-12,14-15,17-18,21-22H,3-10,13H2,1-2H3/t15?,17-,18+/m0/s1 |
| InChIKey | XWCOAFYJKNTNIO-XSRYCBBQSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol?
The IUPAC name of 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol (CID 71173532) is 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol.
What is the SMILES notation for 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol?
The canonical SMILES for 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol is CCCCCCC(C)c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1.
What is the InChIKey of 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol?
The InChIKey is XWCOAFYJKNTNIO-XSRYCBBQSA-N. The full InChI is InChI=1S/C20H32O2/c1-3-4-5-6-8-15(2)16-11-12-19(20(22)14-16)17-9-7-10-18(21)13-17/h11-12,14-15,17-18,21-22H,3-10,13H2,1-2H3/t15?,17-,18+/m0/s1.
What are the key properties of 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol?
2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol has a molecular weight of 304.47 g/mol, XLogP of 5.48, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3R)-3-hydroxycyclohexyl]-5-octan-2-ylphenol is sourced from PubChem (CID 71173532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).