C14H23N3O2 — CID 71173599
1-(4,5-dihydro-1,3-oxazol-4-ylmethyl)-3-(methylamino)-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one (PubChem CID 71173599) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-oxazol-4-ylmethyl)-3-(methylamino)-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one.
| Compound Name | 1-(4,5-dihydro-1,3-oxazol-4-ylmethyl)-3-(methylamino)-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one |
|---|---|
| PubChem CID | 71173599 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-(4,5-dihydro-1,3-oxazol-4-ylmethyl)-3-(methylamino)-3,4,5,5a,6,7,8,8a-octahydrocyclopenta[b]azepin-2-one |
| SMILES | CNC1CCC2CCCC2N(CC2COC=N2)C1=O |
| InChI | InChI=1S/C14H23N3O2/c1-15-12-6-5-10-3-2-4-13(10)17(14(12)18)7-11-8-19-9-16-11/h9-13,15H,2-8H2,1H3 |
| InChIKey | WWINJWQCDSTKOB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |