C23H19F3N2O4 — CID 71173697
3-(methyldiazenyl)-4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]benzoic acid (PubChem CID 71173697) has the molecular formula C23H19F3N2O4 and a molecular weight of 444.41 g/mol. Its IUPAC name is 3-(methyldiazenyl)-4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]benzoic acid.
| Compound Name | 3-(methyldiazenyl)-4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 71173697 |
| Molecular Formula | C23H19F3N2O4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-(methyldiazenyl)-4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]benzoic acid |
| SMILES | C/N=N/c1cc(C(=O)O)ccc1Cc1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H19F3N2O4/c1-27-28-21-13-18(22(29)30)7-6-17(21)12-15-2-8-19(9-3-15)31-14-16-4-10-20(11-5-16)32-23(24,25)26/h2-11,13H,12,14H2,1H3,(H,29,30)/b28-27+ |
| InChIKey | HUKWFSUGYMURQO-BYYHNAKLSA-N |
| XLogP | 6.17 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|