About 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide
9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide (PubChem CID 71173807) has the molecular formula C16H19N5O
and a molecular weight of 297.36 g/mol. Its IUPAC name is 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide |
| PubChem CID | 71173807 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide |
| SMILES | CCNc1nc2c(cc1C(N)=O)c1ccccc1n2CCN |
| InChI | InChI=1S/C16H19N5O/c1-2-19-15-12(14(18)22)9-11-10-5-3-4-6-13(10)21(8-7-17)16(11)20-15/h3-6,9H,2,7-8,17H2,1H3,(H2,18,22)(H,19,20) |
| InChIKey | RGRJMXXWQPGDES-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide?
The IUPAC name of 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide (CID 71173807) is 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide.
What is the SMILES notation for 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide?
The canonical SMILES for 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide is CCNc1nc2c(cc1C(N)=O)c1ccccc1n2CCN.
What is the InChIKey of 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide?
The InChIKey is RGRJMXXWQPGDES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O/c1-2-19-15-12(14(18)22)9-11-10-5-3-4-6-13(10)21(8-7-17)16(11)20-15/h3-6,9H,2,7-8,17H2,1H3,(H2,18,22)(H,19,20).
What are the key properties of 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide?
9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide has a molecular weight of 297.36 g/mol, XLogP of 1.68, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-aminoethyl)-2-(ethylamino)pyrido[2,3-b]indole-3-carboxamide is sourced from PubChem (CID 71173807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).