2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid

C13H16O2 — CID 71174187

IUPAC2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid
SMILESCCc1ccc2c(c1)CC(CC(=O)O)C2
InChIInChI=1S/C13H16O2/c1-2-9-3-4-11-6-10(8-13(14)15)7-12(11)5-9/h3-5,10H,2,6-8H2,1H3,(H,14,15)
InChIKeyFEESIOXSQRPHLG-UHFFFAOYSA-N
MW204.27 g/mol
LogP2.44
Rot. Bonds3

About 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid

2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid (PubChem CID 71174187) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid
PubChem CID71174187
Molecular FormulaC13H16O2
Molecular Weight204.27 g/mol
Exact Mass204.12
IUPAC Name2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid
SMILESCCc1ccc2c(c1)CC(CC(=O)O)C2
InChIInChI=1S/C13H16O2/c1-2-9-3-4-11-6-10(8-13(14)15)7-12(11)5-9/h3-5,10H,2,6-8H2,1H3,(H,14,15)
InChIKeyFEESIOXSQRPHLG-UHFFFAOYSA-N
XLogP2.44
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid?
The IUPAC name of 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid (CID 71174187) is 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid?
The canonical SMILES for 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid is CCc1ccc2c(c1)CC(CC(=O)O)C2.
What is the InChIKey of 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid?
The InChIKey is FEESIOXSQRPHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-9-3-4-11-6-10(8-13(14)15)7-12(11)5-9/h3-5,10H,2,6-8H2,1H3,(H,14,15).
What are the key properties of 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid?
2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid has a molecular weight of 204.27 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2,3-dihydro-1H-inden-2-yl)acetic acid is sourced from PubChem (CID 71174187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).