C20H29NOS — CID 71174213
(4aS,5R,10bS)-9-tert-butyl-5-(thiolan-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71174213) has the molecular formula C20H29NOS and a molecular weight of 331.52 g/mol. Its IUPAC name is (4aS,5R,10bS)-9-tert-butyl-5-(thiolan-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-9-tert-butyl-5-(thiolan-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71174213 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (4aS,5R,10bS)-9-tert-butyl-5-(thiolan-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](C1CCSC1)N2 |
| InChI | InChI=1S/C20H29NOS/c1-20(2,3)14-6-7-17-16(11-14)19-15(5-4-9-22-19)18(21-17)13-8-10-23-12-13/h6-7,11,13,15,18-19,21H,4-5,8-10,12H2,1-3H3/t13?,15-,18-,19-/m0/s1 |
| InChIKey | CPHFTCCPZMCGDV-KNMKIOOSSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |