C31H28N4O4 — CID 71174559
tert-butyl N-[4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)cyclohex-2-en-1-yl]carbamate (PubChem CID 71174559) has the molecular formula C31H28N4O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is tert-butyl N-[4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)cyclohex-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)cyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 71174559 |
| Molecular Formula | C31H28N4O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | tert-butyl N-[4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)cyclohex-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C=CC(n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)NC4=O)CC1 |
| InChI | InChI=1S/C31H28N4O4/c1-31(2,3)39-30(38)32-16-12-14-17(15-13-16)35-21-11-7-5-9-19(21)23-25-24(28(36)34-29(25)37)22-18-8-4-6-10-20(18)33-26(22)27(23)35/h4-12,14,16-17,33H,13,15H2,1-3H3,(H,32,38)(H,34,36,37) |
| InChIKey | GTYMPOVFRRCFSC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|