About 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene
2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene (PubChem CID 71175002) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene |
| PubChem CID | 71175002 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene |
| SMILES | CCOC(C)C1CCc2ccccc2O1 |
| InChI | InChI=1S/C13H18O2/c1-3-14-10(2)12-9-8-11-6-4-5-7-13(11)15-12/h4-7,10,12H,3,8-9H2,1-2H3 |
| InChIKey | ITSSXSFEMQPMGL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene?
The IUPAC name of 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene (CID 71175002) is 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene.
What is the SMILES notation for 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene?
The canonical SMILES for 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene is CCOC(C)C1CCc2ccccc2O1.
What is the InChIKey of 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene?
The InChIKey is ITSSXSFEMQPMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-14-10(2)12-9-8-11-6-4-5-7-13(11)15-12/h4-7,10,12H,3,8-9H2,1-2H3.
What are the key properties of 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene?
2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene has a molecular weight of 206.28 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethoxyethyl)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 71175002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).