About 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid
4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (PubChem CID 71175278) has the molecular formula C13H8ClF3N2O3
and a molecular weight of 332.67 g/mol. Its IUPAC name is 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| PubChem CID | 71175278 |
| Molecular Formula | C13H8ClF3N2O3 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)nc(-c2ccc(Cl)c(F)c2F)c(F)c1N |
| InChI | InChI=1S/C13H8ClF3N2O3/c1-22-12-9(18)8(17)10(19-11(12)13(20)21)4-2-3-5(14)7(16)6(4)15/h2-3H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | KGLMSCJBHSCRSE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The IUPAC name of 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (CID 71175278) is 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
What is the SMILES notation for 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The canonical SMILES for 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid is COc1c(C(=O)O)nc(-c2ccc(Cl)c(F)c2F)c(F)c1N.
What is the InChIKey of 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The InChIKey is KGLMSCJBHSCRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF3N2O3/c1-22-12-9(18)8(17)10(19-11(12)13(20)21)4-2-3-5(14)7(16)6(4)15/h2-3H,1H3,(H2,18,19)(H,20,21).
What are the key properties of 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid has a molecular weight of 332.67 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(4-chloro-2,3-difluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid is sourced from PubChem (CID 71175278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).