About 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid
4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (PubChem CID 71175293) has the molecular formula C13H9Cl2FN2O3
and a molecular weight of 331.13 g/mol. Its IUPAC name is 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| PubChem CID | 71175293 |
| Molecular Formula | C13H9Cl2FN2O3 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)nc(-c2ccc(Cl)c(Cl)c2)c(F)c1N |
| InChI | InChI=1S/C13H9Cl2FN2O3/c1-21-12-9(17)8(16)10(18-11(12)13(19)20)5-2-3-6(14)7(15)4-5/h2-4H,1H3,(H2,17,18)(H,19,20) |
| InChIKey | QPHLZQSAQCEQPP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The IUPAC name of 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (CID 71175293) is 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
What is the SMILES notation for 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The canonical SMILES for 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid is COc1c(C(=O)O)nc(-c2ccc(Cl)c(Cl)c2)c(F)c1N.
What is the InChIKey of 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
The InChIKey is QPHLZQSAQCEQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2FN2O3/c1-21-12-9(17)8(16)10(18-11(12)13(19)20)5-2-3-6(14)7(15)4-5/h2-4H,1H3,(H2,17,18)(H,19,20).
What are the key properties of 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid?
4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid has a molecular weight of 331.13 g/mol, XLogP of 3.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(3,4-dichlorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid is sourced from PubChem (CID 71175293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).