C24H40F2O3 — CID 71175318
methyl 7-[(2R,3R,5S)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3,5-dimethylcyclopentyl]heptanoate (PubChem CID 71175318) has the molecular formula C24H40F2O3 and a molecular weight of 414.58 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3,5-dimethylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R,3R,5S)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3,5-dimethylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71175318 |
| Molecular Formula | C24H40F2O3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-2-[(E,6S)-4,4-difluoro-6-methyl-3-oxooct-1-enyl]-3,5-dimethylcyclopentyl]heptanoate |
| SMILES | CC[C@H](C)CC(F)(F)C(=O)/C=C/[C@@H]1C(CCCCCCC(=O)OC)[C@@H](C)C[C@H]1C |
| InChI | InChI=1S/C24H40F2O3/c1-6-17(2)16-24(25,26)22(27)14-13-21-19(4)15-18(3)20(21)11-9-7-8-10-12-23(28)29-5/h13-14,17-21H,6-12,15-16H2,1-5H3/b14-13+/t17-,18-,19+,20?,21-/m0/s1 |
| InChIKey | SARXYGSKFZGEKP-VTKXVBQTSA-N |
| XLogP | 6.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|