C27H56N8 — CID 71175508
2-[1,3-dimethyl-5-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinan-2-yl]-1,3-dimethyl-5-(2,2,6-trimethylpiperidin-4-yl)-1,3,5-triazinane (PubChem CID 71175508) has the molecular formula C27H56N8 and a molecular weight of 492.80 g/mol. Its IUPAC name is 2-[1,3-dimethyl-5-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinan-2-yl]-1,3-dimethyl-5-(2,2,6-trimethylpiperidin-4-yl)-1,3,5-triazinane.
| Compound Name | 2-[1,3-dimethyl-5-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinan-2-yl]-1,3-dimethyl-5-(2,2,6-trimethylpiperidin-4-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 71175508 |
| Molecular Formula | C27H56N8 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.46 |
| IUPAC Name | 2-[1,3-dimethyl-5-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinan-2-yl]-1,3-dimethyl-5-(2,2,6-trimethylpiperidin-4-yl)-1,3,5-triazinane |
| SMILES | CC1CC(N2CN(C)C(C3N(C)CN(C4CC(C)(C)NC(C)(C)C4)CN3C)N(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C27H56N8/c1-20-12-21(13-25(2,3)28-20)34-16-30(8)23(31(9)17-34)24-32(10)18-35(19-33(24)11)22-14-26(4,5)29-27(6,7)15-22/h20-24,28-29H,12-19H2,1-11H3 |
| InChIKey | OVZRPZRRPDPGDI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |