C21H19Cl3O2 — CID 71176141
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 71176141) has the molecular formula C21H19Cl3O2 and a molecular weight of 409.74 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 71176141 |
| Molecular Formula | C21H19Cl3O2 |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CC1OC(=O)C2CCC(c3ccc(Cl)cc3Cl)C(c3ccc(Cl)cc3)C12 |
| InChI | InChI=1S/C21H19Cl3O2/c1-11-19-17(21(25)26-11)9-8-16(15-7-6-14(23)10-18(15)24)20(19)12-2-4-13(22)5-3-12/h2-7,10-11,16-17,19-20H,8-9H2,1H3 |
| InChIKey | HXDDJHOMKMSRSL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |