C24H25Cl3N2O4 — CID 71176169
2-methoxyethyl N-[(3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate (PubChem CID 71176169) has the molecular formula C24H25Cl3N2O4 and a molecular weight of 511.83 g/mol. Its IUPAC name is 2-methoxyethyl N-[(3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[(3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate |
|---|---|
| PubChem CID | 71176169 |
| Molecular Formula | C24H25Cl3N2O4 |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-methoxyethyl N-[(3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]carbamate |
| SMILES | COCCOC(=O)N[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1CNC2=O |
| InChI | InChI=1S/C24H25Cl3N2O4/c1-32-10-11-33-23(31)29-24-9-8-18(17-7-6-16(26)12-20(17)27)21(19(24)13-28-22(24)30)14-2-4-15(25)5-3-14/h2-7,12,18-19,21H,8-11,13H2,1H3,(H,28,30)(H,29,31)/t18-,19-,21-,24-/m0/s1 |
| InChIKey | ABTNDGAGCDDFPP-RSKVWTTASA-N |
| XLogP | 5.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|