About 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine (PubChem CID 71176216) has the molecular formula C22H26Cl3NO
and a molecular weight of 426.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine |
| PubChem CID | 71176216 |
| Molecular Formula | C22H26Cl3NO |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine |
| SMILES | CC(C)COCC1CCC(c2ccc(Cl)cc2Cl)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H26Cl3NO/c1-15(2)13-27-14-16-3-10-22(20-9-6-18(24)11-21(20)25)26(12-16)19-7-4-17(23)5-8-19/h4-9,11,15-16,22H,3,10,12-14H2,1-2H3 |
| InChIKey | ITBQWWWUQINDGG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine (CID 71176216) is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine.
What is the SMILES notation for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The canonical SMILES for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine is CC(C)COCC1CCC(c2ccc(Cl)cc2Cl)N(c2ccc(Cl)cc2)C1.
What is the InChIKey of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The InChIKey is ITBQWWWUQINDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26Cl3NO/c1-15(2)13-27-14-16-3-10-22(20-9-6-18(24)11-21(20)25)26(12-16)19-7-4-17(23)5-8-19/h4-9,11,15-16,22H,3,10,12-14H2,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine has a molecular weight of 426.82 g/mol, XLogP of 7.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(2-methylpropoxymethyl)piperidine is sourced from PubChem (CID 71176216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).