C22H25F3N8O2 — CID 71176244
(3R)-1-N,1-N,3-N-trimethyl-4-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-3-N-(2,2,2-trifluoroethyl)piperazine-1,3-dicarboxamide (PubChem CID 71176244) has the molecular formula C22H25F3N8O2 and a molecular weight of 490.49 g/mol. Its IUPAC name is (3R)-1-N,1-N,3-N-trimethyl-4-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-3-N-(2,2,2-trifluoroethyl)piperazine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N,1-N,3-N-trimethyl-4-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-3-N-(2,2,2-trifluoroethyl)piperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71176244 |
| Molecular Formula | C22H25F3N8O2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (3R)-1-N,1-N,3-N-trimethyl-4-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-3-N-(2,2,2-trifluoroethyl)piperazine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCN(c2ccnc(-c3c[nH]c4ncccc34)n2)[C@@H](C(=O)N(C)CC(F)(F)F)C1 |
| InChI | InChI=1S/C22H25F3N8O2/c1-30(2)21(35)32-9-10-33(16(12-32)20(34)31(3)13-22(23,24)25)17-6-8-27-19(29-17)15-11-28-18-14(15)5-4-7-26-18/h4-8,11,16H,9-10,12-13H2,1-3H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | KBLRUGHSMJGSFA-MRXNPFEDSA-N |
| XLogP | 2.21 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |