C25H22F3N3O4 — CID 71176767
[1-(6-hydroxy-3-oxo-1H-isoindol-2-yl)-3-methoxy-2-[4-(3,4,5-trifluorophenyl)phenyl]propan-2-yl]urea (PubChem CID 71176767) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is [1-(6-hydroxy-3-oxo-1H-isoindol-2-yl)-3-methoxy-2-[4-(3,4,5-trifluorophenyl)phenyl]propan-2-yl]urea.
| Compound Name | [1-(6-hydroxy-3-oxo-1H-isoindol-2-yl)-3-methoxy-2-[4-(3,4,5-trifluorophenyl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 71176767 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [1-(6-hydroxy-3-oxo-1H-isoindol-2-yl)-3-methoxy-2-[4-(3,4,5-trifluorophenyl)phenyl]propan-2-yl]urea |
| SMILES | COCC(CN1Cc2cc(O)ccc2C1=O)(NC(N)=O)c1ccc(-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C25H22F3N3O4/c1-35-13-25(30-24(29)34,12-31-11-16-8-18(32)6-7-19(16)23(31)33)17-4-2-14(3-5-17)15-9-20(26)22(28)21(27)10-15/h2-10,32H,11-13H2,1H3,(H3,29,30,34) |
| InChIKey | PAKJUMVVFMEWEQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|