About 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione
5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione (PubChem CID 71176846) has the molecular formula C12H8FN3O2S
and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione |
| PubChem CID | 71176846 |
| Molecular Formula | C12H8FN3O2S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2nc(-c3ccc(F)cc3)cs2)N1 |
| InChI | InChI=1S/C12H8FN3O2S/c13-7-3-1-6(2-4-7)8-5-19-11(14-8)9-10(17)16-12(18)15-9/h1-5,9H,(H2,15,16,17,18) |
| InChIKey | BQBOTBVTNGBUBP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione?
The IUPAC name of 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione (CID 71176846) is 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione.
What is the SMILES notation for 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione?
The canonical SMILES for 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione is O=C1NC(=O)C(c2nc(-c3ccc(F)cc3)cs2)N1.
What is the InChIKey of 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione?
The InChIKey is BQBOTBVTNGBUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN3O2S/c13-7-3-1-6(2-4-7)8-5-19-11(14-8)9-10(17)16-12(18)15-9/h1-5,9H,(H2,15,16,17,18).
What are the key properties of 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione?
5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione has a molecular weight of 277.28 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]imidazolidine-2,4-dione is sourced from PubChem (CID 71176846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).