C36H44N2O2 — CID 71178192
(1R)-1-phenyl-N-[[2-[6-[2-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]hexoxy]phenyl]methyl]ethanamine (PubChem CID 71178192) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is (1R)-1-phenyl-N-[[2-[6-[2-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]hexoxy]phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-phenyl-N-[[2-[6-[2-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]hexoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 71178192 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | (1R)-1-phenyl-N-[[2-[6-[2-[[[(1R)-1-phenylethyl]amino]methyl]phenoxy]hexoxy]phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccccc1OCCCCCCOc1ccccc1CN[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44N2O2/c1-29(31-17-7-5-8-18-31)37-27-33-21-11-13-23-35(33)39-25-15-3-4-16-26-40-36-24-14-12-22-34(36)28-38-30(2)32-19-9-6-10-20-32/h5-14,17-24,29-30,37-38H,3-4,15-16,25-28H2,1-2H3/t29-,30-/m1/s1 |
| InChIKey | FAYGARLHUKOEPP-LOYHVIPDSA-N |
| XLogP | 8.41 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|