C21H38O3Si — CID 71178494
(3aR,4R,5R,6aS)-4-[(E)-oct-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 71178494) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-oct-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-oct-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 71178494 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-oct-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38O3Si/c1-5-9-10-11-12-13-14-17-18-15-21(22)23-19(18)16-20(17)24-25(6-2,7-3)8-4/h13-14,17-20H,5-12,15-16H2,1-4H3/b14-13+/t17-,18-,19+,20-/m1/s1 |
| InChIKey | ITGNVGOGZWRLAA-URAHHGQLSA-N |
| XLogP | 5.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|