C11H16N2S — CID 71179455
2-(2-phenyl-1,3-thiazolidin-3-yl)ethanamine (PubChem CID 71179455) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-thiazolidin-3-yl)ethanamine.
| Compound Name | 2-(2-phenyl-1,3-thiazolidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 71179455 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(2-phenyl-1,3-thiazolidin-3-yl)ethanamine |
| SMILES | NCCN1CCSC1c1ccccc1 |
| InChI | InChI=1S/C11H16N2S/c12-6-7-13-8-9-14-11(13)10-4-2-1-3-5-10/h1-5,11H,6-9,12H2 |
| InChIKey | IWLMJULEWNHUOQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |