About [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol
[4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol (PubChem CID 71179468) has the molecular formula C14H17FO2
and a molecular weight of 236.29 g/mol. Its IUPAC name is [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 71179468 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol |
| SMILES | COC1=C(C2C=CC(F)=CC2)C=CC(CO)C1 |
| InChI | InChI=1S/C14H17FO2/c1-17-14-8-10(9-16)2-7-13(14)11-3-5-12(15)6-4-11/h2-3,5-7,10-11,16H,4,8-9H2,1H3 |
| InChIKey | HVDTZJBCNQQSNO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol (CID 71179468) is [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol is COC1=C(C2C=CC(F)=CC2)C=CC(CO)C1.
What is the InChIKey of [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is HVDTZJBCNQQSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FO2/c1-17-14-8-10(9-16)2-7-13(14)11-3-5-12(15)6-4-11/h2-3,5-7,10-11,16H,4,8-9H2,1H3.
What are the key properties of [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol?
[4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 236.29 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-fluorocyclohexa-2,4-dien-1-yl)-5-methoxycyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 71179468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).