C22H29O5P — CID 71179593
(3aS,7aR)-3-[(4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphetan-2-yl)oxy]-2-(2-ethyl-4,6-dimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one (PubChem CID 71179593) has the molecular formula C22H29O5P and a molecular weight of 404.44 g/mol. Its IUPAC name is (3aS,7aR)-3-[(4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphetan-2-yl)oxy]-2-(2-ethyl-4,6-dimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one.
| Compound Name | (3aS,7aR)-3-[(4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphetan-2-yl)oxy]-2-(2-ethyl-4,6-dimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 71179593 |
| Molecular Formula | C22H29O5P |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (3aS,7aR)-3-[(4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphetan-2-yl)oxy]-2-(2-ethyl-4,6-dimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one |
| SMILES | CCc1cc(C)cc(C)c1C1=C(OP2(=O)OC(C)(C)O2)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C22H29O5P/c1-6-15-12-13(2)11-14(3)18(15)19-20(23)16-9-7-8-10-17(16)21(19)25-28(24)26-22(4,5)27-28/h11-12,16-17H,6-10H2,1-5H3/t16-,17+/m1/s1 |
| InChIKey | WHGGWPWNWSIGEF-SJORKVTESA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|