About 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide
11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide (PubChem CID 71179623) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide.
Molecular Properties
| Compound Name | 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide |
| PubChem CID | 71179623 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide |
| SMILES | CCCCCNC(=O)C12CCCC3CC1CC(C2)C3N |
| InChI | InChI=1S/C17H30N2O/c1-2-3-4-8-19-16(20)17-7-5-6-12-9-14(17)10-13(11-17)15(12)18/h12-15H,2-11,18H2,1H3,(H,19,20) |
| InChIKey | HUIALTGEDJGBCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide?
The IUPAC name of 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide (CID 71179623) is 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide.
What is the SMILES notation for 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide?
The canonical SMILES for 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide is CCCCCNC(=O)C12CCCC3CC1CC(C2)C3N.
What is the InChIKey of 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide?
The InChIKey is HUIALTGEDJGBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O/c1-2-3-4-8-19-16(20)17-7-5-6-12-9-14(17)10-13(11-17)15(12)18/h12-15H,2-11,18H2,1H3,(H,19,20).
What are the key properties of 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide?
11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide has a molecular weight of 278.44 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-amino-N-pentyltricyclo[5.3.1.03,9]undecane-3-carboxamide is sourced from PubChem (CID 71179623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).