About 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine
7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71179804) has the molecular formula C20H13Cl3N4O
and a molecular weight of 431.71 g/mol. Its IUPAC name is 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine.
Molecular Properties
| Compound Name | 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
| PubChem CID | 71179804 |
| Molecular Formula | C20H13Cl3N4O |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(Cl)cc(Cl)c3)nc(-c3cccnc3)nc2cc1Cl |
| InChI | InChI=1S/C20H13Cl3N4O/c1-28-18-8-15-17(9-16(18)23)26-19(11-3-2-4-24-10-11)27-20(15)25-14-6-12(21)5-13(22)7-14/h2-10H,1H3,(H,25,26,27) |
| InChIKey | ZKPUDQYIBWZDCK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine?
The IUPAC name of 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine (CID 71179804) is 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine.
What is the SMILES notation for 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine?
The canonical SMILES for 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine is COc1cc2c(Nc3cc(Cl)cc(Cl)c3)nc(-c3cccnc3)nc2cc1Cl.
What is the InChIKey of 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine?
The InChIKey is ZKPUDQYIBWZDCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl3N4O/c1-28-18-8-15-17(9-16(18)23)26-19(11-3-2-4-24-10-11)27-20(15)25-14-6-12(21)5-13(22)7-14/h2-10H,1H3,(H,25,26,27).
What are the key properties of 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine?
7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine has a molecular weight of 431.71 g/mol, XLogP of 6.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-(3,5-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine is sourced from PubChem (CID 71179804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).