C24H26FN3O2 — CID 71179933
N'-[(1E)-1-[3-(4-fluorophenyl)-5-methoxycyclohexa-2,4-dien-1-ylidene]-4-methoxybutyl]pyridine-3-carboximidamide (PubChem CID 71179933) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is N'-[(1E)-1-[3-(4-fluorophenyl)-5-methoxycyclohexa-2,4-dien-1-ylidene]-4-methoxybutyl]pyridine-3-carboximidamide.
| Compound Name | N'-[(1E)-1-[3-(4-fluorophenyl)-5-methoxycyclohexa-2,4-dien-1-ylidene]-4-methoxybutyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 71179933 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N'-[(1E)-1-[3-(4-fluorophenyl)-5-methoxycyclohexa-2,4-dien-1-ylidene]-4-methoxybutyl]pyridine-3-carboximidamide |
| SMILES | COCCCC(/N=C(\N)c1cccnc1)=C1\C=C(c2ccc(F)cc2)C=C(OC)C1 |
| InChI | InChI=1S/C24H26FN3O2/c1-29-12-4-6-23(28-24(26)18-5-3-11-27-16-18)20-13-19(14-22(15-20)30-2)17-7-9-21(25)10-8-17/h3,5,7-11,13-14,16H,4,6,12,15H2,1-2H3,(H2,26,28)/b23-20- |
| InChIKey | MBPKIMHXJQLMJD-ATJXCDBQSA-N |
| XLogP | 4.62 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|