About 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine
6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71180234) has the molecular formula C23H15F2N5O
and a molecular weight of 415.40 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine.
Molecular Properties
| Compound Name | 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine |
| PubChem CID | 71180234 |
| Molecular Formula | C23H15F2N5O |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | Fc1ccc(-c2ccc3nc(-c4cccnc4)nc(NCc4ncco4)c3c2)c(F)c1 |
| InChI | InChI=1S/C23H15F2N5O/c24-16-4-5-17(19(25)11-16)14-3-6-20-18(10-14)23(28-13-21-27-8-9-31-21)30-22(29-20)15-2-1-7-26-12-15/h1-12H,13H2,(H,28,29,30) |
| InChIKey | CWDYANPVYFYVEO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine?
The IUPAC name of 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine (CID 71180234) is 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine.
What is the SMILES notation for 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine?
The canonical SMILES for 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine is Fc1ccc(-c2ccc3nc(-c4cccnc4)nc(NCc4ncco4)c3c2)c(F)c1.
What is the InChIKey of 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine?
The InChIKey is CWDYANPVYFYVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2N5O/c24-16-4-5-17(19(25)11-16)14-3-6-20-18(10-14)23(28-13-21-27-8-9-31-21)30-22(29-20)15-2-1-7-26-12-15/h1-12H,13H2,(H,28,29,30).
What are the key properties of 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine?
6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine has a molecular weight of 415.40 g/mol, XLogP of 5.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-2-pyridin-3-ylquinazolin-4-amine is sourced from PubChem (CID 71180234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).