About 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine
6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71180728) has the molecular formula C22H20N4O
and a molecular weight of 356.43 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine.
Molecular Properties
| Compound Name | 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine |
| PubChem CID | 71180728 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1ccccc1-c1ccc2nc(-c3cccnc3)nc(N(C)C)c2c1 |
| InChI | InChI=1S/C22H20N4O/c1-26(2)22-18-13-15(17-8-4-5-9-20(17)27-3)10-11-19(18)24-21(25-22)16-7-6-12-23-14-16/h4-14H,1-3H3 |
| InChIKey | YRVTTXQOBDPHMP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine?
The IUPAC name of 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine (CID 71180728) is 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine.
What is the SMILES notation for 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine?
The canonical SMILES for 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine is COc1ccccc1-c1ccc2nc(-c3cccnc3)nc(N(C)C)c2c1.
What is the InChIKey of 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine?
The InChIKey is YRVTTXQOBDPHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O/c1-26(2)22-18-13-15(17-8-4-5-9-20(17)27-3)10-11-19(18)24-21(25-22)16-7-6-12-23-14-16/h4-14H,1-3H3.
What are the key properties of 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine?
6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine has a molecular weight of 356.43 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyphenyl)-N,N-dimethyl-2-pyridin-3-ylquinazolin-4-amine is sourced from PubChem (CID 71180728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).